C23H35NO2 — CID 73043158
1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)pentan-1-one (PubChem CID 73043158) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)pentan-1-one.
| Compound Name | 1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 73043158 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1OC2CC(C)CCC2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO2/c1-5-6-12-20(25)22-24(16-18-10-8-7-9-11-18)23(3,4)19-14-13-17(2)15-21(19)26-22/h7-11,17,19,21-22H,5-6,12-16H2,1-4H3 |
| InChIKey | CWVCSUDHTDBKRU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |