C28H39NO2Se — CID 134930797
(2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-1-phenylselanylpropyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134930797) has the molecular formula C28H39NO2Se and a molecular weight of 500.59 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-1-phenylselanylpropyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-1-phenylselanylpropyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134930797 |
| Molecular Formula | C28H39NO2Se |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-1-phenylselanylpropyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CO[C@H](C)[C@@H]([Se]c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H39NO2Se/c1-20-16-17-24-25(18-20)31-27(26(21(2)30-5)32-23-14-10-7-11-15-23)29(28(24,3)4)19-22-12-8-6-9-13-22/h6-15,20-21,24-27H,16-19H2,1-5H3/t20-,21-,24-,25-,26-,27+/m1/s1 |
| InChIKey | ADPCHDHLRVRAQX-PTGATOOUSA-N |
| XLogP | 5.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|