C24H32NOP — CID 134970395
2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine (PubChem CID 134970395) has the molecular formula C24H32NOP and a molecular weight of 381.50 g/mol. Its IUPAC name is 2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine.
| Compound Name | 2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine |
|---|---|
| PubChem CID | 134970395 |
| Molecular Formula | C24H32NOP |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine |
| SMILES | CC1CCC2C(C1)OP(Cc1ccccc1)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C24H32NOP/c1-19-14-15-22-23(16-19)26-27(18-21-12-8-5-9-13-21)25(24(22,2)3)17-20-10-6-4-7-11-20/h4-13,19,22-23H,14-18H2,1-3H3 |
| InChIKey | ZGCHPCQBWUJKSJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|