C33H41NO2Se — CID 11692586
(2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11692586) has the molecular formula C33H41NO2Se and a molecular weight of 562.66 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11692586 |
| Molecular Formula | C33H41NO2Se |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CO[C@H](c1ccccc1)[C@@H]([Se]c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H41NO2Se/c1-24-20-21-28-29(22-24)36-32(34(33(28,2)3)23-25-14-8-5-9-15-25)31(37-27-18-12-7-13-19-27)30(35-4)26-16-10-6-11-17-26/h5-19,24,28-32H,20-23H2,1-4H3/t24-,28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | SIFASXHEDBXPCD-XOZZHLMTSA-N |
| XLogP | 6.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|