C25H32BrNO — CID 134868819
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868819) has the molecular formula C25H32BrNO and a molecular weight of 442.44 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868819 |
| Molecular Formula | C25H32BrNO |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)O[C@H](c1ccccc1)N(CCc1ccccc1Br)C2(C)C |
| InChI | InChI=1S/C25H32BrNO/c1-18-13-14-21-23(17-18)28-24(20-10-5-4-6-11-20)27(25(21,2)3)16-15-19-9-7-8-12-22(19)26/h4-12,18,21,23-24H,13-17H2,1-3H3/t18-,21-,23-,24+/m0/s1 |
| InChIKey | NSKMYRFNUOIGDH-INDWIESVSA-N |
| XLogP | 6.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |