C23H36BrNO — CID 134868818
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(2-methylpropyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868818) has the molecular formula C23H36BrNO and a molecular weight of 422.45 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(2-methylpropyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(2-methylpropyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868818 |
| Molecular Formula | C23H36BrNO |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(2-methylpropyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CC(C)C[C@H]1O[C@H]2C[C@@H](C)CC[C@@H]2C(C)(C)N1CCc1ccccc1Br |
| InChI | InChI=1S/C23H36BrNO/c1-16(2)14-22-25(13-12-18-8-6-7-9-20(18)24)23(4,5)19-11-10-17(3)15-21(19)26-22/h6-9,16-17,19,21-22H,10-15H2,1-5H3/t17-,19-,21-,22+/m0/s1 |
| InChIKey | PZWQKBGCAFEJCV-XODARUQUSA-N |
| XLogP | 6.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |