C22H32BrNO — CID 135077362
(2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methylbut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077362) has the molecular formula C22H32BrNO and a molecular weight of 406.41 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methylbut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methylbut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077362 |
| Molecular Formula | C22H32BrNO |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methylbut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C/C=C(\C)CN1[C@H](c2ccccc2Br)OC2C[C@H](C)CCC2C1(C)C |
| InChI | InChI=1S/C22H32BrNO/c1-6-15(2)14-24-21(17-9-7-8-10-19(17)23)25-20-13-16(3)11-12-18(20)22(24,4)5/h6-10,16,18,20-21H,11-14H2,1-5H3/b15-6+/t16-,18?,20?,21+/m1/s1 |
| InChIKey | KKZZQYHICICQLH-XEVBDACISA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|