C27H36BrNO2 — CID 134868868
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868868) has the molecular formula C27H36BrNO2 and a molecular weight of 486.49 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868868 |
| Molecular Formula | C27H36BrNO2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)O[C@H](COCc1ccccc1)N(CCc1ccccc1Br)C2(C)C |
| InChI | InChI=1S/C27H36BrNO2/c1-20-13-14-23-25(17-20)31-26(19-30-18-21-9-5-4-6-10-21)29(27(23,2)3)16-15-22-11-7-8-12-24(22)28/h4-12,20,23,25-26H,13-19H2,1-3H3/t20-,23-,25-,26+/m0/s1 |
| InChIKey | UKUKUGOQAFHKJQ-IDCRYQTOSA-N |
| XLogP | 6.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |