C21H30BrNO — CID 135077361
(2S,7R)-2-(2-bromophenyl)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077361) has the molecular formula C21H30BrNO and a molecular weight of 392.38 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077361 |
| Molecular Formula | C21H30BrNO |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C/C=C/CN1[C@H](c2ccccc2Br)OC2C[C@H](C)CCC2C1(C)C |
| InChI | InChI=1S/C21H30BrNO/c1-5-6-13-23-20(16-9-7-8-10-18(16)22)24-19-14-15(2)11-12-17(19)21(23,3)4/h5-10,15,17,19-20H,11-14H2,1-4H3/b6-5+/t15-,17?,19?,20+/m1/s1 |
| InChIKey | QEFHICJQOOYAHL-IGLUYANNSA-N |
| XLogP | 5.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|