C21H29NO — CID 134997673
(1S,8R,15R)-8-ethenyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134997673) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (1S,8R,15R)-8-ethenyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,8R,15R)-8-ethenyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134997673 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (1S,8R,15R)-8-ethenyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | C=C[C@H]1CN2[C@@H](OC3C[C@H](C)CCC3C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H29NO/c1-5-15-13-22-20(17-9-7-6-8-16(15)17)23-19-12-14(2)10-11-18(19)21(22,3)4/h5-9,14-15,18-20H,1,10-13H2,2-4H3/t14-,15+,18?,19?,20+/m1/s1 |
| InChIKey | MEJXNWCMLVVZDV-HQTRJIGVSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|