C12H15NO — CID 15981604
2,3,4,6,7,11b-hexahydro-[1,3]oxazino[2,3-a]isoquinoline (PubChem CID 15981604) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,3,4,6,7,11b-hexahydro-[1,3]oxazino[2,3-a]isoquinoline.
| Compound Name | 2,3,4,6,7,11b-hexahydro-[1,3]oxazino[2,3-a]isoquinoline |
|---|---|
| PubChem CID | 15981604 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,3,4,6,7,11b-hexahydro-[1,3]oxazino[2,3-a]isoquinoline |
| SMILES | c1ccc2c(c1)CCN1CCCOC21 |
| InChI | InChI=1S/C12H15NO/c1-2-5-11-10(4-1)6-8-13-7-3-9-14-12(11)13/h1-2,4-5,12H,3,6-9H2 |
| InChIKey | RIYBAQUIWHZLKT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |