C20H30BrNO — CID 134869020
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134869020) has the molecular formula C20H30BrNO and a molecular weight of 380.37 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134869020 |
| Molecular Formula | C20H30BrNO |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)O[C@H](C)N(CCc1ccccc1Br)C2(C)C |
| InChI | InChI=1S/C20H30BrNO/c1-14-9-10-17-19(13-14)23-15(2)22(20(17,3)4)12-11-16-7-5-6-8-18(16)21/h5-8,14-15,17,19H,9-13H2,1-4H3/t14-,15+,17-,19-/m0/s1 |
| InChIKey | VDRZCTRIIMZROC-HIRMHNASSA-N |
| XLogP | 5.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |