C28H36BrNO2 — CID 135077370
(2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-4-phenylmethoxybut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077370) has the molecular formula C28H36BrNO2 and a molecular weight of 498.51 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-4-phenylmethoxybut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-4-phenylmethoxybut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077370 |
| Molecular Formula | C28H36BrNO2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-4-phenylmethoxybut-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CCC2C(C1)O[C@@H](c1ccccc1Br)N(C/C=C/COCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C28H36BrNO2/c1-21-15-16-24-26(19-21)32-27(23-13-7-8-14-25(23)29)30(28(24,2)3)17-9-10-18-31-20-22-11-5-4-6-12-22/h4-14,21,24,26-27H,15-20H2,1-3H3/b10-9+/t21-,24?,26?,27+/m1/s1 |
| InChIKey | XDDWSJOYSFRLQP-PZLZFDOSSA-N |
| XLogP | 7.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|