C26H33NO — CID 134998691
(1S,8S,15R)-8-benzyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134998691) has the molecular formula C26H33NO and a molecular weight of 375.56 g/mol. Its IUPAC name is (1S,8S,15R)-8-benzyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,8S,15R)-8-benzyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134998691 |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (1S,8S,15R)-8-benzyl-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | C[C@@H]1CCC2C(C1)O[C@H]1c3ccccc3[C@H](Cc3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C26H33NO/c1-18-13-14-23-24(15-18)28-25-22-12-8-7-11-21(22)20(17-27(25)26(23,2)3)16-19-9-5-4-6-10-19/h4-12,18,20,23-25H,13-17H2,1-3H3/t18-,20-,23?,24?,25+/m1/s1 |
| InChIKey | YJXZOYDXMLUWFO-QRDVMUARSA-N |
| XLogP | 5.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |