C27H34BrNO — CID 135077367
(2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methyl-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077367) has the molecular formula C27H34BrNO and a molecular weight of 468.48 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methyl-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methyl-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077367 |
| Molecular Formula | C27H34BrNO |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-[(E)-2-methyl-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C/C(=C\c1ccccc1)CN1[C@H](c2ccccc2Br)OC2C[C@H](C)CCC2C1(C)C |
| InChI | InChI=1S/C27H34BrNO/c1-19-14-15-23-25(17-19)30-26(22-12-8-9-13-24(22)28)29(27(23,3)4)18-20(2)16-21-10-6-5-7-11-21/h5-13,16,19,23,25-26H,14-15,17-18H2,1-4H3/b20-16+/t19-,23?,25?,26+/m1/s1 |
| InChIKey | PWZNEXXADYOZBC-YBASBPQPSA-N |
| XLogP | 7.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |