C27H35NO — CID 134997297
(1S,8S,15R)-8-benzyl-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134997297) has the molecular formula C27H35NO and a molecular weight of 389.58 g/mol. Its IUPAC name is (1S,8S,15R)-8-benzyl-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,8S,15R)-8-benzyl-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134997297 |
| Molecular Formula | C27H35NO |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (1S,8S,15R)-8-benzyl-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | C[C@@H]1CCC2C(C1)O[C@H]1c3ccccc3[C@](C)(Cc3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C27H35NO/c1-19-14-15-23-24(16-19)29-25-21-12-8-9-13-22(21)27(4,18-28(25)26(23,2)3)17-20-10-6-5-7-11-20/h5-13,19,23-25H,14-18H2,1-4H3/t19-,23?,24?,25+,27-/m1/s1 |
| InChIKey | XSQJNVNPXVFXDS-ZKBDHRAASA-N |
| XLogP | 6.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |