C29H40BrNO3 — CID 134868890
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868890) has the molecular formula C29H40BrNO3 and a molecular weight of 530.55 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868890 |
| Molecular Formula | C29H40BrNO3 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1ccc(CC[C@H]2O[C@H]3C[C@@H](C)CC[C@@H]3C(C)(C)N2CCc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C29H40BrNO3/c1-20-10-13-23-26(18-20)34-28(15-12-21-11-14-25(32-4)27(19-21)33-5)31(29(23,2)3)17-16-22-8-6-7-9-24(22)30/h6-9,11,14,19-20,23,26,28H,10,12-13,15-18H2,1-5H3/t20-,23-,26-,28+/m0/s1 |
| InChIKey | RUJAGIFFBBYVLA-YFRXONQNSA-N |
| XLogP | 6.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |