C28H38BrNO3 — CID 134868889
(2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868889) has the molecular formula C28H38BrNO3 and a molecular weight of 516.52 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868889 |
| Molecular Formula | C28H38BrNO3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromophenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1ccc(C[C@H]2O[C@H]3C[C@@H](C)CC[C@@H]3C(C)(C)N2CCc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C28H38BrNO3/c1-19-10-12-22-25(16-19)33-27(18-20-11-13-24(31-4)26(17-20)32-5)30(28(22,2)3)15-14-21-8-6-7-9-23(21)29/h6-9,11,13,17,19,22,25,27H,10,12,14-16,18H2,1-5H3/t19-,22-,25-,27+/m0/s1 |
| InChIKey | WXMPGBSBJWEXDC-KUVOVLKESA-N |
| XLogP | 6.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |