C22H34BrNO3 — CID 134868904
(2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868904) has the molecular formula C22H34BrNO3 and a molecular weight of 440.42 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868904 |
| Molecular Formula | C22H34BrNO3 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1cc(Br)c(CCN2[C@@H](C)O[C@H]3C[C@@H](C)CC[C@@H]3C2(C)C)cc1OC |
| InChI | InChI=1S/C22H34BrNO3/c1-14-7-8-17-19(11-14)27-15(2)24(22(17,3)4)10-9-16-12-20(25-5)21(26-6)13-18(16)23/h12-15,17,19H,7-11H2,1-6H3/t14-,15+,17-,19-/m0/s1 |
| InChIKey | CQEGVZUWTNPPAA-HIRMHNASSA-N |
| XLogP | 5.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |