C20H30BrNO3 — CID 85234673
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 85234673) has the molecular formula C20H30BrNO3 and a molecular weight of 412.37 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 85234673 |
| Molecular Formula | C20H30BrNO3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | COc1cc(Br)c(CC2NC(C)(C)C3CCC(C)CC3O2)cc1OC |
| InChI | InChI=1S/C20H30BrNO3/c1-12-6-7-14-16(8-12)25-19(22-20(14,2)3)10-13-9-17(23-4)18(24-5)11-15(13)21/h9,11-12,14,16,19,22H,6-8,10H2,1-5H3 |
| InChIKey | VIZHQFGJOWBXGV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |