C30H42BrNO5 — CID 134868884
(2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134868884) has the molecular formula C30H42BrNO5 and a molecular weight of 576.57 g/mol. Its IUPAC name is (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134868884 |
| Molecular Formula | C30H42BrNO5 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | (2R,4aR,7S,8aS)-3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1ccc(C[C@H]2O[C@H]3C[C@@H](C)CC[C@@H]3C(C)(C)N2CCc2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C30H42BrNO5/c1-19-8-10-22-25(14-19)37-29(16-20-9-11-24(33-4)26(15-20)34-5)32(30(22,2)3)13-12-21-17-27(35-6)28(36-7)18-23(21)31/h9,11,15,17-19,22,25,29H,8,10,12-14,16H2,1-7H3/t19-,22-,25-,29+/m0/s1 |
| InChIKey | FHTDUNFRMUAOHD-NNDZDTOGSA-N |
| XLogP | 6.51 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |