C29H40BrNO4 — CID 85219500
3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 85219500) has the molecular formula C29H40BrNO4 and a molecular weight of 546.55 g/mol. Its IUPAC name is 3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | 3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 85219500 |
| Molecular Formula | C29H40BrNO4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 3-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1cc(Br)c(CCN2C(COCc3ccccc3)OC3CC(C)CCC3C2(C)C)cc1OC |
| InChI | InChI=1S/C29H40BrNO4/c1-20-11-12-23-25(15-20)35-28(19-34-18-21-9-7-6-8-10-21)31(29(23,2)3)14-13-22-16-26(32-4)27(33-5)17-24(22)30/h6-10,16-17,20,23,25,28H,11-15,18-19H2,1-5H3 |
| InChIKey | FLKWRRFUKKAERS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |