C29H40LiNO4 — CID 134969939
lithium 3-[2-(3,4-dimethoxybenzene-6-id-1-yl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 134969939) has the molecular formula C29H40LiNO4 and a molecular weight of 473.58 g/mol. Its IUPAC name is lithium 3-[2-(3,4-dimethoxybenzene-6-id-1-yl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | lithium 3-[2-(3,4-dimethoxybenzene-6-id-1-yl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134969939 |
| Molecular Formula | C29H40LiNO4 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | lithium 3-[2-(3,4-dimethoxybenzene-6-id-1-yl)ethyl]-4,4,7-trimethyl-2-(phenylmethoxymethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1c[c-]c(CCN2C(COCc3ccccc3)OC3CC(C)CCC3C2(C)C)cc1OC.[Li+] |
| InChI | InChI=1S/C29H40NO4.Li/c1-21-11-13-24-26(17-21)34-28(20-33-19-23-9-7-6-8-10-23)30(29(24,2)3)16-15-22-12-14-25(31-4)27(18-22)32-5;/h6-10,14,18,21,24,26,28H,11,13,15-17,19-20H2,1-5H3;/q-1;+1 |
| InChIKey | WCJGFKJXOCNPPM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|