C22H31NO2 — CID 11244763
(3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-phenyl-9-oxa-1-azatricyclo[8.5.0.03,8]pentadec-13-en-11-ol (PubChem CID 11244763) has the molecular formula C22H31NO2 and a molecular weight of 341.49 g/mol. Its IUPAC name is (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-phenyl-9-oxa-1-azatricyclo[8.5.0.03,8]pentadec-13-en-11-ol.
| Compound Name | (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-phenyl-9-oxa-1-azatricyclo[8.5.0.03,8]pentadec-13-en-11-ol |
|---|---|
| PubChem CID | 11244763 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-phenyl-9-oxa-1-azatricyclo[8.5.0.03,8]pentadec-13-en-11-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]1N(CC=CC[C@@]1(O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C22H31NO2/c1-16-11-12-18-19(15-16)25-20-22(24,17-9-5-4-6-10-17)13-7-8-14-23(20)21(18,2)3/h4-10,16,18-20,24H,11-15H2,1-3H3/t16-,18-,19-,20+,22-/m1/s1 |
| InChIKey | CJXMBNVQMJCWCR-ZEWLQOSNSA-N |
| XLogP | 4.08 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|