About 1-morpholin-4-yl-2,3-diphenylpentan-3-ol
1-morpholin-4-yl-2,3-diphenylpentan-3-ol (PubChem CID 23604838) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-morpholin-4-yl-2,3-diphenylpentan-3-ol.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-2,3-diphenylpentan-3-ol |
| PubChem CID | 23604838 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-morpholin-4-yl-2,3-diphenylpentan-3-ol |
| SMILES | CCC(O)(c1ccccc1)C(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-2-21(23,19-11-7-4-8-12-19)20(18-9-5-3-6-10-18)17-22-13-15-24-16-14-22/h3-12,20,23H,2,13-17H2,1H3 |
| InChIKey | IZFLSEIGJMOVRV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-morpholin-4-yl-2,3-diphenylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-2,3-diphenylpentan-3-ol?
The IUPAC name of 1-morpholin-4-yl-2,3-diphenylpentan-3-ol (CID 23604838) is 1-morpholin-4-yl-2,3-diphenylpentan-3-ol.
What is the SMILES notation for 1-morpholin-4-yl-2,3-diphenylpentan-3-ol?
The canonical SMILES for 1-morpholin-4-yl-2,3-diphenylpentan-3-ol is CCC(O)(c1ccccc1)C(CN1CCOCC1)c1ccccc1.
What is the InChIKey of 1-morpholin-4-yl-2,3-diphenylpentan-3-ol?
The InChIKey is IZFLSEIGJMOVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO2/c1-2-21(23,19-11-7-4-8-12-19)20(18-9-5-3-6-10-18)17-22-13-15-24-16-14-22/h3-12,20,23H,2,13-17H2,1H3.
What are the key properties of 1-morpholin-4-yl-2,3-diphenylpentan-3-ol?
1-morpholin-4-yl-2,3-diphenylpentan-3-ol has a molecular weight of 325.45 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-2,3-diphenylpentan-3-ol is sourced from PubChem (CID 23604838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).