C28H37NO2Se — CID 139192205
(3S,6R,8R,10S,13S,14R)-2,2,6,14-tetramethyl-13-phenyl-14-phenylselanyl-9,12-dioxa-1-azatricyclo[8.5.0.03,8]pentadecane (PubChem CID 139192205) has the molecular formula C28H37NO2Se and a molecular weight of 498.57 g/mol. Its IUPAC name is (3S,6R,8R,10S,13S,14R)-2,2,6,14-tetramethyl-13-phenyl-14-phenylselanyl-9,12-dioxa-1-azatricyclo[8.5.0.03,8]pentadecane.
| Compound Name | (3S,6R,8R,10S,13S,14R)-2,2,6,14-tetramethyl-13-phenyl-14-phenylselanyl-9,12-dioxa-1-azatricyclo[8.5.0.03,8]pentadecane |
|---|---|
| PubChem CID | 139192205 |
| Molecular Formula | C28H37NO2Se |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (3S,6R,8R,10S,13S,14R)-2,2,6,14-tetramethyl-13-phenyl-14-phenylselanyl-9,12-dioxa-1-azatricyclo[8.5.0.03,8]pentadecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1CO[C@@H](c3ccccc3)[C@](C)([Se]c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C28H37NO2Se/c1-20-15-16-23-24(17-20)31-25-18-30-26(21-11-7-5-8-12-21)28(4,19-29(25)27(23,2)3)32-22-13-9-6-10-14-22/h5-14,20,23-26H,15-19H2,1-4H3/t20-,23-,24-,25+,26+,28-/m1/s1 |
| InChIKey | BTIRWNWCZMINJZ-XHIHKJDDSA-N |
| XLogP | 5.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|