C27H37NO2Se — CID 134936167
(2S,4aS,7R,8S,8aR)-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 134936167) has the molecular formula C27H37NO2Se and a molecular weight of 486.56 g/mol. Its IUPAC name is (2S,4aS,7R,8S,8aR)-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8S,8aR)-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134936167 |
| Molecular Formula | C27H37NO2Se |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (2S,4aS,7R,8S,8aR)-2-[(1R,2R)-2-methoxy-2-phenyl-1-phenylselanylethyl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | CO[C@H](c1ccccc1)[C@@H]([Se]c1ccccc1)[C@H]1NC(C)(C)[C@@H]2CC[C@@H](C)[C@H](C)[C@H]2O1 |
| InChI | InChI=1S/C27H37NO2Se/c1-18-16-17-22-23(19(18)2)30-26(28-27(22,3)4)25(31-21-14-10-7-11-15-21)24(29-5)20-12-8-6-9-13-20/h6-15,18-19,22-26,28H,16-17H2,1-5H3/t18-,19+,22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | QOSIDZMNIRYWOU-ONNHWEMZSA-N |
| XLogP | 4.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|