C20H29NO — CID 134880128
(2S,4aS,7R,8S,8aR)-4,4,7,8-tetramethyl-2-[(E)-2-phenylethenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 134880128) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (2S,4aS,7R,8S,8aR)-4,4,7,8-tetramethyl-2-[(E)-2-phenylethenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8S,8aR)-4,4,7,8-tetramethyl-2-[(E)-2-phenylethenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 134880128 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (2S,4aS,7R,8S,8aR)-4,4,7,8-tetramethyl-2-[(E)-2-phenylethenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | C[C@@H]1[C@H]2O[C@@H](/C=C/c3ccccc3)NC(C)(C)[C@@H]2CC[C@H]1C |
| InChI | InChI=1S/C20H29NO/c1-14-10-12-17-19(15(14)2)22-18(21-20(17,3)4)13-11-16-8-6-5-7-9-16/h5-9,11,13-15,17-19,21H,10,12H2,1-4H3/b13-11+/t14-,15+,17-,18+,19-/m1/s1 |
| InChIKey | XTBOECYTIJHMSG-IXYKAYDKSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |