C21H31NOSe — CID 10668233
(2S,4aS,7R,8aR)-2-ethenyl-4,4,7-trimethyl-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10668233) has the molecular formula C21H31NOSe and a molecular weight of 392.45 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-2-ethenyl-4,4,7-trimethyl-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-2-ethenyl-4,4,7-trimethyl-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10668233 |
| Molecular Formula | C21H31NOSe |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2S,4aS,7R,8aR)-2-ethenyl-4,4,7-trimethyl-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C=C[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1CC[Se]c1ccccc1 |
| InChI | InChI=1S/C21H31NOSe/c1-5-20-22(13-14-24-17-9-7-6-8-10-17)21(3,4)18-12-11-16(2)15-19(18)23-20/h5-10,16,18-20H,1,11-15H2,2-4H3/t16-,18-,19-,20+/m1/s1 |
| InChIKey | SPJZVVCXSRQOBK-AFYVEPGGSA-N |
| XLogP | 3.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|