C19H29NOSe — CID 10832714
(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(1R)-1-phenylselanylethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 10832714) has the molecular formula C19H29NOSe and a molecular weight of 366.41 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(1R)-1-phenylselanylethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(1R)-1-phenylselanylethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10832714 |
| Molecular Formula | C19H29NOSe |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(1R)-1-phenylselanylethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]([C@@H](C)[Se]c1ccccc1)NC2(C)C |
| InChI | InChI=1S/C19H29NOSe/c1-13-10-11-16-17(12-13)21-18(20-19(16,3)4)14(2)22-15-8-6-5-7-9-15/h5-9,13-14,16-18,20H,10-12H2,1-4H3/t13-,14-,16-,17-,18+/m1/s1 |
| InChIKey | BDFBBUYJLRGEJF-TWPTVVAISA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|