C26H41NO2Se — CID 139192206
(3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-11-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 139192206) has the molecular formula C26H41NO2Se and a molecular weight of 478.58 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-11-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-11-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 139192206 |
| Molecular Formula | C26H41NO2Se |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-11-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | CC(C)[C@@H]1O[C@H](C(C)(C)[Se]c2ccccc2)CN2[C@H]1O[C@@H]1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C26H41NO2Se/c1-17(2)23-24-27(25(4,5)20-14-13-18(3)15-21(20)28-24)16-22(29-23)26(6,7)30-19-11-9-8-10-12-19/h8-12,17-18,20-24H,13-16H2,1-7H3/t18-,20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | YROYTXXLCATNAJ-RQRCJAGTSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|