C27H35NOSe — CID 10576244
(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(E)-2-phenylethenyl]-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10576244) has the molecular formula C27H35NOSe and a molecular weight of 468.54 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(E)-2-phenylethenyl]-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(E)-2-phenylethenyl]-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10576244 |
| Molecular Formula | C27H35NOSe |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[(E)-2-phenylethenyl]-3-(2-phenylselanylethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](/C=C/c1ccccc1)N(CC[Se]c1ccccc1)C2(C)C |
| InChI | InChI=1S/C27H35NOSe/c1-21-14-16-24-25(20-21)29-26(17-15-22-10-6-4-7-11-22)28(27(24,2)3)18-19-30-23-12-8-5-9-13-23/h4-13,15,17,21,24-26H,14,16,18-20H2,1-3H3/b17-15+/t21-,24-,25-,26+/m1/s1 |
| InChIKey | QTMZTDTZITZVEJ-JGOGPZNTSA-N |
| XLogP | 5.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|