C20H27NO — CID 5375386
1-[(E)-2-phenylethenyl]-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline (PubChem CID 5375386) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline.
| Compound Name | 1-[(E)-2-phenylethenyl]-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline |
|---|---|
| PubChem CID | 5375386 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline |
| SMILES | C(=C/C1OCCC2CC3CCCCC3CN21)\c1ccccc1 |
| InChI | InChI=1S/C20H27NO/c1-2-6-16(7-3-1)10-11-20-21-15-18-9-5-4-8-17(18)14-19(21)12-13-22-20/h1-3,6-7,10-11,17-20H,4-5,8-9,12-15H2/b11-10+ |
| InChIKey | XISBJMJPNCHNFG-ZHACJKMWSA-N |
| XLogP | 4.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |