C20H25NO — CID 155742757
1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;1,1'-biphenyl (PubChem CID 155742757) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;1,1'-biphenyl.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;1,1'-biphenyl |
|---|---|
| PubChem CID | 155742757 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;1,1'-biphenyl |
| SMILES | C1CCN2CCOCC2C1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H15NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-9-5-6-10-7-8(9)3-1/h1-10H;8H,1-7H2 |
| InChIKey | BNHTVWNQXRIUGF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |