C19H27NO — CID 591659
1-benzyl-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline (PubChem CID 591659) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-benzyl-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline.
| Compound Name | 1-benzyl-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline |
|---|---|
| PubChem CID | 591659 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-benzyl-1,3,4,4a,5,5a,6,7,8,9,9a,10-dodecahydro-[1,3]oxazino[3,4-b]isoquinoline |
| SMILES | c1ccc(CC2OCCC3CC4CCCCC4CN32)cc1 |
| InChI | InChI=1S/C19H27NO/c1-2-6-15(7-3-1)12-19-20-14-17-9-5-4-8-16(17)13-18(20)10-11-21-19/h1-3,6-7,16-19H,4-5,8-14H2 |
| InChIKey | SOQVJVQHIHHTSF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |