C16H24ClNO — CID 16719459
(1R,2S,9aR)-2-methoxy-1-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;hydrochloride (PubChem CID 16719459) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is (1R,2S,9aR)-2-methoxy-1-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;hydrochloride.
| Compound Name | (1R,2S,9aR)-2-methoxy-1-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;hydrochloride |
|---|---|
| PubChem CID | 16719459 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (1R,2S,9aR)-2-methoxy-1-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;hydrochloride |
| SMILES | CO[C@H]1CCN2CCCC[C@@H]2[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C16H23NO.ClH/c1-18-15-10-12-17-11-6-5-9-14(17)16(15)13-7-3-2-4-8-13;/h2-4,7-8,14-16H,5-6,9-12H2,1H3;1H/t14-,15+,16-;/m1./s1 |
| InChIKey | WDSMSCHEQIXUJD-GBEOHXTHSA-N |
| XLogP | 3.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |