C18H29NOSe — CID 10570110
(1R,2S,5R)-5-methyl-2-[2-(2-phenylselanylethylamino)propan-2-yl]cyclohexan-1-ol (PubChem CID 10570110) has the molecular formula C18H29NOSe and a molecular weight of 354.40 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-[2-(2-phenylselanylethylamino)propan-2-yl]cyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-5-methyl-2-[2-(2-phenylselanylethylamino)propan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10570110 |
| Molecular Formula | C18H29NOSe |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-[2-(2-phenylselanylethylamino)propan-2-yl]cyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)NCC[Se]c2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C18H29NOSe/c1-14-9-10-16(17(20)13-14)18(2,3)19-11-12-21-15-7-5-4-6-8-15/h4-8,14,16-17,19-20H,9-13H2,1-3H3/t14-,16-,17-/m1/s1 |
| InChIKey | SQJKNSBWUGAJHQ-DJIMGWMZSA-N |
| XLogP | 2.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|