C23H31NO — CID 143070049
(5R,8E)-5-(2-methylphenyl)-8-[(2Z)-2-propan-2-ylpenta-2,4-dienylidene]-2,3,4,4a,5,6,7,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 143070049) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (5R,8E)-5-(2-methylphenyl)-8-[(2Z)-2-propan-2-ylpenta-2,4-dienylidene]-2,3,4,4a,5,6,7,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (5R,8E)-5-(2-methylphenyl)-8-[(2Z)-2-propan-2-ylpenta-2,4-dienylidene]-2,3,4,4a,5,6,7,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 143070049 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (5R,8E)-5-(2-methylphenyl)-8-[(2Z)-2-propan-2-ylpenta-2,4-dienylidene]-2,3,4,4a,5,6,7,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | C=C/C=C(\C=C1/CN[C@@H](c2ccccc2C)C2CCCOC12)C(C)C |
| InChI | InChI=1S/C23H31NO/c1-5-9-18(16(2)3)14-19-15-24-22(20-11-7-6-10-17(20)4)21-12-8-13-25-23(19)21/h5-7,9-11,14,16,21-24H,1,8,12-13,15H2,2-4H3/b18-9+,19-14+/t21?,22-,23?/m0/s1 |
| InChIKey | VSCMMFFFODDGRD-OBEQKTSBSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|