C21H24F3NO — CID 143070114
8-methyl-7-[(Z)-3-methylidenepent-1-enyl]-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 143070114) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is 8-methyl-7-[(Z)-3-methylidenepent-1-enyl]-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | 8-methyl-7-[(Z)-3-methylidenepent-1-enyl]-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 143070114 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 8-methyl-7-[(Z)-3-methylidenepent-1-enyl]-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | C=C(/C=C\C1=C(C)C2OCCCC2C(c2cc(F)c(F)cc2F)N1)CC |
| InChI | InChI=1S/C21H24F3NO/c1-4-12(2)7-8-19-13(3)21-14(6-5-9-26-21)20(25-19)15-10-17(23)18(24)11-16(15)22/h7-8,10-11,14,20-21,25H,2,4-6,9H2,1,3H3/b8-7- |
| InChIKey | KRISPIUVFSOKPA-FPLPWBNLSA-N |
| XLogP | 5.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|