C24H31NOSe — CID 10717416
(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[phenyl(phenylselanyl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 10717416) has the molecular formula C24H31NOSe and a molecular weight of 428.48 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[phenyl(phenylselanyl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[phenyl(phenylselanyl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10717416 |
| Molecular Formula | C24H31NOSe |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-2-[phenyl(phenylselanyl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C([Se]c1ccccc1)c1ccccc1)NC2(C)C |
| InChI | InChI=1S/C24H31NOSe/c1-17-14-15-20-21(16-17)26-23(25-24(20,2)3)22(18-10-6-4-7-11-18)27-19-12-8-5-9-13-19/h4-13,17,20-23,25H,14-16H2,1-3H3/t17-,20-,21-,22?,23+/m1/s1 |
| InChIKey | GDOZHKVLNORGOR-VCHAZVNRSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|