C29H41NO2Se — CID 11991925
(1R,2S,5R)-2-[2-[(2S,6S)-7,7-dimethyl-2-phenyl-6-phenylselanyl-1,4-oxazepan-4-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 11991925) has the molecular formula C29H41NO2Se and a molecular weight of 514.61 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-[(2S,6S)-7,7-dimethyl-2-phenyl-6-phenylselanyl-1,4-oxazepan-4-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-[(2S,6S)-7,7-dimethyl-2-phenyl-6-phenylselanyl-1,4-oxazepan-4-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11991925 |
| Molecular Formula | C29H41NO2Se |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (1R,2S,5R)-2-[2-[(2S,6S)-7,7-dimethyl-2-phenyl-6-phenylselanyl-1,4-oxazepan-4-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)N2C[C@H]([Se]c3ccccc3)C(C)(C)O[C@@H](c3ccccc3)C2)[C@H](O)C1 |
| InChI | InChI=1S/C29H41NO2Se/c1-21-16-17-24(25(31)18-21)28(2,3)30-19-26(22-12-8-6-9-13-22)32-29(4,5)27(20-30)33-23-14-10-7-11-15-23/h6-15,21,24-27,31H,16-20H2,1-5H3/t21-,24-,25-,26-,27+/m1/s1 |
| InChIKey | UAEJFCLUGOAWLN-YWFGMZBWSA-N |
| XLogP | 5.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|