C23H35NO2 — CID 11485113
(3S)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-6-methyl-3-phenyl-4,7-dihydro-2H-azepin-3-ol (PubChem CID 11485113) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3S)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-6-methyl-3-phenyl-4,7-dihydro-2H-azepin-3-ol.
| Compound Name | (3S)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-6-methyl-3-phenyl-4,7-dihydro-2H-azepin-3-ol |
|---|---|
| PubChem CID | 11485113 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3S)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-6-methyl-3-phenyl-4,7-dihydro-2H-azepin-3-ol |
| SMILES | CC1=CC[C@](O)(c2ccccc2)CN(C(C)(C)[C@@H]2CC[C@@H](C)C[C@H]2O)C1 |
| InChI | InChI=1S/C23H35NO2/c1-17-10-11-20(21(25)14-17)22(3,4)24-15-18(2)12-13-23(26,16-24)19-8-6-5-7-9-19/h5-9,12,17,20-21,25-26H,10-11,13-16H2,1-4H3/t17-,20-,21-,23-/m1/s1 |
| InChIKey | GWKWVNGRIVJHJI-XMXZMMKCSA-N |
| XLogP | 4.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|