C34H43NO3Se — CID 11534449
(2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-(2-methoxyphenyl)-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11534449) has the molecular formula C34H43NO3Se and a molecular weight of 592.68 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-(2-methoxyphenyl)-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-(2-methoxyphenyl)-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11534449 |
| Molecular Formula | C34H43NO3Se |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(1R,2R)-2-methoxy-2-(2-methoxyphenyl)-1-phenylselanylethyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1ccccc1[C@@H](OC)[C@@H]([Se]c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H43NO3Se/c1-24-20-21-28-30(22-24)38-33(35(34(28,2)3)23-25-14-8-6-9-15-25)32(39-26-16-10-7-11-17-26)31(37-5)27-18-12-13-19-29(27)36-4/h6-19,24,28,30-33H,20-23H2,1-5H3/t24-,28-,30-,31-,32-,33+/m1/s1 |
| InChIKey | XZHSZLHUGKHHPX-DYPMLSAQSA-N |
| XLogP | 6.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|