C33H38N2O2 — CID 102300093
(2S,4aS,7R,8aR)-3-benzyl-2-[(4R,5R)-3,5-diphenyl-4,5-dihydro-1,2-oxazol-4-yl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 102300093) has the molecular formula C33H38N2O2 and a molecular weight of 494.68 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-2-[(4R,5R)-3,5-diphenyl-4,5-dihydro-1,2-oxazol-4-yl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(4R,5R)-3,5-diphenyl-4,5-dihydro-1,2-oxazol-4-yl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 102300093 |
| Molecular Formula | C33H38N2O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-2-[(4R,5R)-3,5-diphenyl-4,5-dihydro-1,2-oxazol-4-yl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]([C@@H]1C(c3ccccc3)=NO[C@H]1c1ccccc1)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C33H38N2O2/c1-23-19-20-27-28(21-23)36-32(35(33(27,2)3)22-24-13-7-4-8-14-24)29-30(25-15-9-5-10-16-25)34-37-31(29)26-17-11-6-12-18-26/h4-18,23,27-29,31-32H,19-22H2,1-3H3/t23-,27-,28-,29-,31+,32+/m1/s1 |
| InChIKey | LUVOJPBFLCZMSM-AOMSRJFLSA-N |
| XLogP | 7.22 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |