C22H32N2O2 — CID 11142848
(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11142848) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11142848 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CC1=NO[C@@H]([C@@H]2O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N2Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N2O2/c1-15-10-11-18-19(12-15)25-21(20-13-16(2)23-26-20)24(22(18,3)4)14-17-8-6-5-7-9-17/h5-9,15,18-21H,10-14H2,1-4H3/t15-,18-,19-,20-,21+/m1/s1 |
| InChIKey | XXCKQNKGPIYVDG-WEUUYRGXSA-N |
| XLogP | 4.59 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |