C27H44F3NO2Si — CID 11569588
[(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-yl]oxy-trimethylsilane (PubChem CID 11569588) has the molecular formula C27H44F3NO2Si and a molecular weight of 499.73 g/mol. Its IUPAC name is [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-yl]oxy-trimethylsilane.
| Compound Name | [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11569588 |
| Molecular Formula | C27H44F3NO2Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorohexan-2-yl]oxy-trimethylsilane |
| SMILES | CCCC[C@](O[Si](C)(C)C)([C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H44F3NO2Si/c1-8-9-17-26(27(28,29)30,33-34(5,6)7)24-31(19-21-13-11-10-12-14-21)25(3,4)22-16-15-20(2)18-23(22)32-24/h10-14,20,22-24H,8-9,15-19H2,1-7H3/t20-,22-,23-,24+,26+/m1/s1 |
| InChIKey | XLLIKQNNKPKDCO-FLMRIKBJSA-N |
| XLogP | 7.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|