C25H31NO2 — CID 11567027
[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone (PubChem CID 11567027) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is [(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone.
| Compound Name | [(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11567027 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | [(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)c1ccccc1)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C25H31NO2/c1-18-14-15-21-22(16-18)28-24(23(27)20-12-8-5-9-13-20)26(25(21,2)3)17-19-10-6-4-7-11-19/h4-13,18,21-22,24H,14-17H2,1-3H3/t18-,21-,22-,24+/m1/s1 |
| InChIKey | VORZDQFWOQZUBD-ZZSVKSCCSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |