C19H29NO — CID 10902267
(2S,4aS,7R,8aR)-3-benzyl-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10902267) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10902267 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C19H29NO/c1-14-10-11-17-18(12-14)21-15(2)20(19(17,3)4)13-16-8-6-5-7-9-16/h5-9,14-15,17-18H,10-13H2,1-4H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | DWHGIXKJTNAINL-CYGHRXIMSA-N |
| XLogP | 4.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |