C21H31NO3S — CID 14571047
1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylsulfinylethanone (PubChem CID 14571047) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylsulfinylethanone.
| Compound Name | 1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylsulfinylethanone |
|---|---|
| PubChem CID | 14571047 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylsulfinylethanone |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)CS(C)=O)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C21H31NO3S/c1-15-10-11-17-19(12-15)25-20(18(23)14-26(4)24)22(21(17,2)3)13-16-8-6-5-7-9-16/h5-9,15,17,19-20H,10-14H2,1-4H3/t15-,17-,19-,20+,26?/m1/s1 |
| InChIKey | URMRRSIENPVCHA-RDWMRVKSSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |