C19H26N4O6 — CID 134878489
[(3S,4R,5R,6R)-5-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyoxan-3-yl] acetate (PubChem CID 134878489) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-5-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6R)-5-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 134878489 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(3S,4R,5R,6R)-5-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CO[C@@H](OCc2ccccc2)[C@H](N=[N+]=[N-])[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N4O6/c1-12(24)28-14-11-27-17(26-10-13-8-6-5-7-9-13)16(22-23-20)15(14)21-18(25)29-19(2,3)4/h5-9,14-17H,10-11H2,1-4H3,(H,21,25)/t14-,15+,16-,17-/m1/s1 |
| InChIKey | NGUFKMZLAOUAIZ-YYIAUSFCSA-N |
| XLogP | 3.06 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|